jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

In part one of this experiment, a 0.20 kg mass hangs vertically from a spring and an elongation below the support point of the spring of 9.50 cm is recorded. Wi

The rate expression for a first order reaction could be A.) Rate=k[A] B.) Rate=k[A]^2[B] C.) Rate=k[A][B] D.) Rate=k[A]^2[B]^2

A series of enzymes catalyze the reactions in the metabolic pathway X → Y → Z → A. Product A binds to the enzyme that converts X to Y at a position remote from

The arithmetic sequence 1, 3, 5, 7, 9, . . . represents the set of odd natural numbers. What is the explicit rule for the sequence? ak = ____ +____ (k - 1)

Judy is opening a small business producing high-quality paper products and decided to place a green pine tree on all product boxes and on the sign outside the f

can someone explain to me and give me the answer cause i don’t get it

how do I solve (-2-6i) (1 + i)

How was the government involved in the civil rights movement

It has been observed that some persons who suffer acute heartburn, again suffer acute heartburn within one year of the first episode. This is due, in part, to d

Describe the headright system of land distribution in Georgia.