03-08-2016
History

contestada

what is a signifcant contrubition from woman and how did it affect us?

Respuesta :

03-08-2016

I would say during World War 1 and 2 when many of the men left, they took up their jobs and carried the country preventing it from collapse.

Answer Link

Otras preguntas

What is a GUI? Question 1 options: Every aspect of an Operating system Anything a computer uses to interact with a user A small box that is used to get input f

Why are longer wars less supportive to the American public than shorter wars?

the reduced fraction of 1902/21

Please help! With the picture!

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

There are 48 students. 8 are sick, one-fifth of the remaining students sent cards to them. How many students wrote cards? Please explain

In “The Negro Speaks of Rivers,” Hughes describes rivers as “dusky” to call attention to their ____.? a.darkness c.mystery b.age d.sadness

The following is an example of which type of chemical reaction?AgNO3 (aq) + NaCl (aq) --> AgCl (s) + NaNO3 (aq) Single replacement Decomposition Double r

Using the distributive property, which of the following expressions is equivalent to 4(3 + 4y)? 12 + 16y 12 + 4y 7 + 4y 7 + 8y

How much higher is checkpoint 4 than checkpoint 1 checkpoint 1= -86 checkpoint 4= 2,177